C15H16ClN3O4 — CID 118573836
[(1S)-1-[5-chloro-4-oxo-3-(oxolan-3-yl)quinazolin-2-yl]ethyl]carbamic acid (PubChem CID 118573836) has the molecular formula C15H16ClN3O4 and a molecular weight of 337.76 g/mol. Its IUPAC name is [(1S)-1-[5-chloro-4-oxo-3-(oxolan-3-yl)quinazolin-2-yl]ethyl]carbamic acid.
| Compound Name | [(1S)-1-[5-chloro-4-oxo-3-(oxolan-3-yl)quinazolin-2-yl]ethyl]carbamic acid |
|---|---|
| PubChem CID | 118573836 |
| Molecular Formula | C15H16ClN3O4 |
| Molecular Weight | 337.76 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | [(1S)-1-[5-chloro-4-oxo-3-(oxolan-3-yl)quinazolin-2-yl]ethyl]carbamic acid |
| SMILES | C[C@H](NC(=O)O)c1nc2cccc(Cl)c2c(=O)n1C1CCOC1 |
| InChI | InChI=1S/C15H16ClN3O4/c1-8(17-15(21)22)13-18-11-4-2-3-10(16)12(11)14(20)19(13)9-5-6-23-7-9/h2-4,8-9,17H,5-7H2,1H3,(H,21,22)/t8-,9?/m0/s1 |
| InChIKey | JIWNPHQWTCHTSU-IENPIDJESA-N |
| XLogP | 2.34 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.76 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |