C19H18ClN3O4 — CID 90233105
1-[5-chloro-3-(3-methoxy-2-methylphenyl)-4-oxoquinazolin-2-yl]ethylcarbamic acid (PubChem CID 90233105) has the molecular formula C19H18ClN3O4 and a molecular weight of 387.82 g/mol. Its IUPAC name is 1-[5-chloro-3-(3-methoxy-2-methylphenyl)-4-oxoquinazolin-2-yl]ethylcarbamic acid.
| Compound Name | 1-[5-chloro-3-(3-methoxy-2-methylphenyl)-4-oxoquinazolin-2-yl]ethylcarbamic acid |
|---|---|
| PubChem CID | 90233105 |
| Molecular Formula | C19H18ClN3O4 |
| Molecular Weight | 387.82 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | 1-[5-chloro-3-(3-methoxy-2-methylphenyl)-4-oxoquinazolin-2-yl]ethylcarbamic acid |
| SMILES | COc1cccc(-n2c(C(C)NC(=O)O)nc3cccc(Cl)c3c2=O)c1C |
| InChI | InChI=1S/C19H18ClN3O4/c1-10-14(8-5-9-15(10)27-3)23-17(11(2)21-19(25)26)22-13-7-4-6-12(20)16(13)18(23)24/h4-9,11,21H,1-3H3,(H,25,26) |
| InChIKey | NUWQYIHQRPTPOT-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.82 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |