C11H10Cl2N4O — CID 123675119
2-[(2,5-dichloropyrimidin-4-yl)amino]-2-pyridin-3-ylethanol (PubChem CID 123675119) has the molecular formula C11H10Cl2N4O and a molecular weight of 285.13 g/mol. Its IUPAC name is 2-[(2,5-dichloropyrimidin-4-yl)amino]-2-pyridin-3-ylethanol.
| Compound Name | 2-[(2,5-dichloropyrimidin-4-yl)amino]-2-pyridin-3-ylethanol |
|---|---|
| PubChem CID | 123675119 |
| Molecular Formula | C11H10Cl2N4O |
| Molecular Weight | 285.13 g/mol |
| Exact Mass | 284.02 |
| IUPAC Name | 2-[(2,5-dichloropyrimidin-4-yl)amino]-2-pyridin-3-ylethanol |
| SMILES | OCC(Nc1nc(Cl)ncc1Cl)c1cccnc1 |
| InChI | InChI=1S/C11H10Cl2N4O/c12-8-5-15-11(13)17-10(8)16-9(6-18)7-2-1-3-14-4-7/h1-5,9,18H,6H2,(H,15,16,17) |
| InChIKey | BKQRGMLHXHMGHH-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.13 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |