C20H33ClO5 — CID 123675133
ethyl 6-chloro-5,7-diethoxy-2-(1-ethoxyethenyl)-2,6-dimethylocta-4,7-dienoate (PubChem CID 123675133) has the molecular formula C20H33ClO5 and a molecular weight of 388.93 g/mol. Its IUPAC name is ethyl 6-chloro-5,7-diethoxy-2-(1-ethoxyethenyl)-2,6-dimethylocta-4,7-dienoate.
| Compound Name | ethyl 6-chloro-5,7-diethoxy-2-(1-ethoxyethenyl)-2,6-dimethylocta-4,7-dienoate |
|---|---|
| PubChem CID | 123675133 |
| Molecular Formula | C20H33ClO5 |
| Molecular Weight | 388.93 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | ethyl 6-chloro-5,7-diethoxy-2-(1-ethoxyethenyl)-2,6-dimethylocta-4,7-dienoate |
| SMILES | C=C(OCC)C(C)(Cl)C(=CCC(C)(C(=C)OCC)C(=O)OCC)OCC |
| InChI | InChI=1S/C20H33ClO5/c1-9-23-15(5)19(7,18(22)26-12-4)14-13-17(25-11-3)20(8,21)16(6)24-10-2/h13H,5-6,9-12,14H2,1-4,7-8H3 |
| InChIKey | RBLDSDRDIMAWPT-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.93 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|