C15H26O3 — CID 87388198
ethyl (2R)-2-(2,2-dimethylpropanoyl)-2,5-dimethylhex-4-enoate (PubChem CID 87388198) has the molecular formula C15H26O3 and a molecular weight of 254.37 g/mol. Its IUPAC name is ethyl (2R)-2-(2,2-dimethylpropanoyl)-2,5-dimethylhex-4-enoate.
| Compound Name | ethyl (2R)-2-(2,2-dimethylpropanoyl)-2,5-dimethylhex-4-enoate |
|---|---|
| PubChem CID | 87388198 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | ethyl (2R)-2-(2,2-dimethylpropanoyl)-2,5-dimethylhex-4-enoate |
| SMILES | CCOC(=O)[C@](C)(CC=C(C)C)C(=O)C(C)(C)C |
| InChI | InChI=1S/C15H26O3/c1-8-18-13(17)15(7,10-9-11(2)3)12(16)14(4,5)6/h9H,8,10H2,1-7H3/t15-/m1/s1 |
| InChIKey | VJJWGBOUYUOUMO-OAHLLOKOSA-N |
| XLogP | 3.53 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|