C15H18N4O — CID 123677051
4-(2,2-dimethylpropoxy)-5-[(Z)-3-isocyanoprop-2-enyl]-7H-pyrrolo[2,3-d]pyrimidine (PubChem CID 123677051) has the molecular formula C15H18N4O and a molecular weight of 270.34 g/mol. Its IUPAC name is 4-(2,2-dimethylpropoxy)-5-[(Z)-3-isocyanoprop-2-enyl]-7H-pyrrolo[2,3-d]pyrimidine.
| Compound Name | 4-(2,2-dimethylpropoxy)-5-[(Z)-3-isocyanoprop-2-enyl]-7H-pyrrolo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 123677051 |
| Molecular Formula | C15H18N4O |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 4-(2,2-dimethylpropoxy)-5-[(Z)-3-isocyanoprop-2-enyl]-7H-pyrrolo[2,3-d]pyrimidine |
| SMILES | [C-]#[N+]/C=C\Cc1c[nH]c2ncnc(OCC(C)(C)C)c12 |
| InChI | InChI=1S/C15H18N4O/c1-15(2,3)9-20-14-12-11(6-5-7-16-4)8-17-13(12)18-10-19-14/h5,7-8,10H,6,9H2,1-3H3,(H,17,18,19)/b7-5- |
| InChIKey | CIVRKHFYERTRAN-ALCCZGGFSA-N |
| XLogP | 3.36 |
| TPSA | 55.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|