C9H17N2+ — CID 123677821
1,4-dimethyl-2,3,4,7-tetrahydroazocin-1-ium-5-amine (PubChem CID 123677821) has the molecular formula C9H17N2+ and a molecular weight of 153.25 g/mol. Its IUPAC name is 1,4-dimethyl-2,3,4,7-tetrahydroazocin-1-ium-5-amine.
| Compound Name | 1,4-dimethyl-2,3,4,7-tetrahydroazocin-1-ium-5-amine |
|---|---|
| PubChem CID | 123677821 |
| Molecular Formula | C9H17N2+ |
| Molecular Weight | 153.25 g/mol |
| Exact Mass | 153.14 |
| IUPAC Name | 1,4-dimethyl-2,3,4,7-tetrahydroazocin-1-ium-5-amine |
| SMILES | CC1CC/[N+](C)=C\CC=C1N |
| InChI | InChI=1S/C9H17N2/c1-8-5-7-11(2)6-3-4-9(8)10/h4,6,8H,3,5,7,10H2,1-2H3/q+1/b9-4?,11-6- |
| InChIKey | OPYRDUFVDMJATQ-JBPBGBFWSA-N |
| XLogP | 0.97 |
| TPSA | 29.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.25 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|