C6H13NO — CID 123680572
2-ethyl-4-methyl-1,2-oxazolidine (PubChem CID 123680572) has the molecular formula C6H13NO and a molecular weight of 115.18 g/mol. Its IUPAC name is 2-ethyl-4-methyl-1,2-oxazolidine.
| Compound Name | 2-ethyl-4-methyl-1,2-oxazolidine |
|---|---|
| PubChem CID | 123680572 |
| Molecular Formula | C6H13NO |
| Molecular Weight | 115.18 g/mol |
| Exact Mass | 115.10 |
| IUPAC Name | 2-ethyl-4-methyl-1,2-oxazolidine |
| SMILES | CCN1CC(C)CO1 |
| InChI | InChI=1S/C6H13NO/c1-3-7-4-6(2)5-8-7/h6H,3-5H2,1-2H3 |
| InChIKey | SOFZTMQWFSKIRI-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 115.18 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |