C47H53N13O10S2 — CID 123683032
2-amino-N,N'-bis[2-[2-[2-[5-[[5-(furan-2-yl)-1,3,4-thiadiazol-2-yl]carbamoyl]-2-methylbenzimidazol-1-yl]ethoxy]ethoxy]ethyl]pentanediamide (PubChem CID 123683032) has the molecular formula C47H53N13O10S2 and a molecular weight of 1024.16 g/mol. Its IUPAC name is 2-amino-N,N'-bis[2-[2-[2-[5-[[5-(furan-2-yl)-1,3,4-thiadiazol-2-yl]carbamoyl]-2-methylbenzimidazol-1-yl]ethoxy]ethoxy]ethyl]pentanediamide.
| Compound Name | 2-amino-N,N'-bis[2-[2-[2-[5-[[5-(furan-2-yl)-1,3,4-thiadiazol-2-yl]carbamoyl]-2-methylbenzimidazol-1-yl]ethoxy]ethoxy]ethyl]pentanediamide |
|---|---|
| PubChem CID | 123683032 |
| Molecular Formula | C47H53N13O10S2 |
| Molecular Weight | 1024.16 g/mol |
| Exact Mass | 1023.35 |
| IUPAC Name | 2-amino-N,N'-bis[2-[2-[2-[5-[[5-(furan-2-yl)-1,3,4-thiadiazol-2-yl]carbamoyl]-2-methylbenzimidazol-1-yl]ethoxy]ethoxy]ethyl]pentanediamide |
| SMILES | Cc1nc2cc(C(=O)Nc3nnc(-c4ccco4)s3)ccc2n1CCOCCOCCNC(=O)CCC(N)C(=O)NCCOCCOCCn1c(C)nc2cc(C(=O)Nc3nnc(-c4ccco4)s3)ccc21 |
| InChI | InChI=1S/C47H53N13O10S2/c1-29-51-34-27-31(41(62)53-46-57-55-44(71-46)38-5-3-17-69-38)7-10-36(34)59(29)15-21-67-25-23-65-19-13-49-40(61)12-9-33(48)43(64)50-14-20-66-24-26-68-22-16-60-30(2)52-35-28-32(8-11-37(35)60)42(63)54-47-58-56-45(72-47)39-6-4-18-70-39/h3-8,10-11,17-18,27-28,33H,9,12-16,19-26,48H2,1-2H3,(H,49,61)(H,50,64)(H,53,57,62)(H,54,58,63) |
| InChIKey | GHCJQUZRGOTGBV-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 292.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 21 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1024.16 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 21 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|