C13H23NO — CID 123683182
1-ethoxy-1,3-dimethyl-2-methylidene-3,5,6,7,8,8a-hexahydroindolizine (PubChem CID 123683182) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is 1-ethoxy-1,3-dimethyl-2-methylidene-3,5,6,7,8,8a-hexahydroindolizine.
| Compound Name | 1-ethoxy-1,3-dimethyl-2-methylidene-3,5,6,7,8,8a-hexahydroindolizine |
|---|---|
| PubChem CID | 123683182 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | 1-ethoxy-1,3-dimethyl-2-methylidene-3,5,6,7,8,8a-hexahydroindolizine |
| SMILES | C=C1C(C)N2CCCCC2C1(C)OCC |
| InChI | InChI=1S/C13H23NO/c1-5-15-13(4)10(2)11(3)14-9-7-6-8-12(13)14/h11-12H,2,5-9H2,1,3-4H3 |
| InChIKey | OZUGKFSWNKGRGJ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|