C13H23NO — CID 164922044
6-methylidene-8a-(propan-2-yloxymethyl)-1,2,3,5,7,8-hexahydroindolizine (PubChem CID 164922044) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is 6-methylidene-8a-(propan-2-yloxymethyl)-1,2,3,5,7,8-hexahydroindolizine.
| Compound Name | 6-methylidene-8a-(propan-2-yloxymethyl)-1,2,3,5,7,8-hexahydroindolizine |
|---|---|
| PubChem CID | 164922044 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | 6-methylidene-8a-(propan-2-yloxymethyl)-1,2,3,5,7,8-hexahydroindolizine |
| SMILES | C=C1CCC2(COC(C)C)CCCN2C1 |
| InChI | InChI=1S/C13H23NO/c1-11(2)15-10-13-6-4-8-14(13)9-12(3)5-7-13/h11H,3-10H2,1-2H3 |
| InChIKey | IWASGJHGCOSGQJ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|