C12H20INO — CID 164922775
8a-[[(1S)-1-iodoethoxy]methyl]-6-methylidene-1,2,3,5,7,8-hexahydroindolizine (PubChem CID 164922775) has the molecular formula C12H20INO and a molecular weight of 321.20 g/mol. Its IUPAC name is 8a-[[(1S)-1-iodoethoxy]methyl]-6-methylidene-1,2,3,5,7,8-hexahydroindolizine.
| Compound Name | 8a-[[(1S)-1-iodoethoxy]methyl]-6-methylidene-1,2,3,5,7,8-hexahydroindolizine |
|---|---|
| PubChem CID | 164922775 |
| Molecular Formula | C12H20INO |
| Molecular Weight | 321.20 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | 8a-[[(1S)-1-iodoethoxy]methyl]-6-methylidene-1,2,3,5,7,8-hexahydroindolizine |
| SMILES | C=C1CCC2(CO[C@H](C)I)CCCN2C1 |
| InChI | InChI=1S/C12H20INO/c1-10-4-6-12(9-15-11(2)13)5-3-7-14(12)8-10/h11H,1,3-9H2,2H3/t11-,12?/m1/s1 |
| InChIKey | FWPFILPHFACZTJ-JHJMLUEUSA-N |
| XLogP | 2.97 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.20 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|