C25H44N2O2 — CID 176926604
ethane;8-(ethoxymethyl)-2,6-dimethylidene-1,3,5,7-tetrahydropyrrolizine;8-(ethoxymethyl)-6-methylidene-2,3,5,7-tetrahydro-1H-pyrrolizine (PubChem CID 176926604) has the molecular formula C25H44N2O2 and a molecular weight of 404.64 g/mol. Its IUPAC name is ethane;8-(ethoxymethyl)-2,6-dimethylidene-1,3,5,7-tetrahydropyrrolizine;8-(ethoxymethyl)-6-methylidene-2,3,5,7-tetrahydro-1H-pyrrolizine.
| Compound Name | ethane;8-(ethoxymethyl)-2,6-dimethylidene-1,3,5,7-tetrahydropyrrolizine;8-(ethoxymethyl)-6-methylidene-2,3,5,7-tetrahydro-1H-pyrrolizine |
|---|---|
| PubChem CID | 176926604 |
| Molecular Formula | C25H44N2O2 |
| Molecular Weight | 404.64 g/mol |
| Exact Mass | 404.34 |
| IUPAC Name | ethane;8-(ethoxymethyl)-2,6-dimethylidene-1,3,5,7-tetrahydropyrrolizine;8-(ethoxymethyl)-6-methylidene-2,3,5,7-tetrahydro-1H-pyrrolizine |
| SMILES | C=C1CN2CC(=C)CC2(COCC)C1.C=C1CN2CCCC2(COCC)C1.CC |
| InChI | InChI=1S/C12H19NO.C11H19NO.C2H6/c1-4-14-9-12-5-10(2)7-13(12)8-11(3)6-12;1-3-13-9-11-5-4-6-12(11)8-10(2)7-11;1-2/h2-9H2,1H3;2-9H2,1H3;1-2H3 |
| InChIKey | OBEOFZIOQURLCP-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.64 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|