C11H20N2O2 — CID 176663573
(Z,8S)-8-(ethoxymethyl)-N-methoxy-3,5,6,7-tetrahydro-1H-pyrrolizin-2-imine (PubChem CID 176663573) has the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. Its IUPAC name is (Z,8S)-8-(ethoxymethyl)-N-methoxy-3,5,6,7-tetrahydro-1H-pyrrolizin-2-imine.
| Compound Name | (Z,8S)-8-(ethoxymethyl)-N-methoxy-3,5,6,7-tetrahydro-1H-pyrrolizin-2-imine |
|---|---|
| PubChem CID | 176663573 |
| Molecular Formula | C11H20N2O2 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | (Z,8S)-8-(ethoxymethyl)-N-methoxy-3,5,6,7-tetrahydro-1H-pyrrolizin-2-imine |
| SMILES | CCOC[C@@]12CCCN1C/C(=N\OC)C2 |
| InChI | InChI=1S/C11H20N2O2/c1-3-15-9-11-5-4-6-13(11)8-10(7-11)12-14-2/h3-9H2,1-2H3/b12-10-/t11-/m0/s1 |
| InChIKey | VICJQFOWFILKDE-NIANNCQZSA-N |
| XLogP | 1.26 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|