C11H21NO3 — CID 171786358
8-(methoxymethyl)-1,2,3,5,6,7-hexahydropyrrolizine;methyl formate (PubChem CID 171786358) has the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. Its IUPAC name is 8-(methoxymethyl)-1,2,3,5,6,7-hexahydropyrrolizine;methyl formate.
| Compound Name | 8-(methoxymethyl)-1,2,3,5,6,7-hexahydropyrrolizine;methyl formate |
|---|---|
| PubChem CID | 171786358 |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | 8-(methoxymethyl)-1,2,3,5,6,7-hexahydropyrrolizine;methyl formate |
| SMILES | COC=O.COCC12CCCN1CCC2 |
| InChI | InChI=1S/C9H17NO.C2H4O2/c1-11-8-9-4-2-6-10(9)7-3-5-9;1-4-2-3/h2-8H2,1H3;2H,1H3 |
| InChIKey | OPSHUUMEOMYDJA-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|