C10H17NO — CID 177033593
8-(ethenoxymethyl)-1,2,3,5,6,7-hexahydropyrrolizine (PubChem CID 177033593) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is 8-(ethenoxymethyl)-1,2,3,5,6,7-hexahydropyrrolizine.
| Compound Name | 8-(ethenoxymethyl)-1,2,3,5,6,7-hexahydropyrrolizine |
|---|---|
| PubChem CID | 177033593 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | 8-(ethenoxymethyl)-1,2,3,5,6,7-hexahydropyrrolizine |
| SMILES | C=COCC12CCCN1CCC2 |
| InChI | InChI=1S/C10H17NO/c1-2-12-9-10-5-3-7-11(10)8-4-6-10/h2H,1,3-9H2 |
| InChIKey | LBNUQLKJGKTRIY-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|