C11H19NO — CID 170726733
8-(prop-1-en-2-yloxymethyl)-1,2,3,5,6,7-hexahydropyrrolizine (PubChem CID 170726733) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is 8-(prop-1-en-2-yloxymethyl)-1,2,3,5,6,7-hexahydropyrrolizine.
| Compound Name | 8-(prop-1-en-2-yloxymethyl)-1,2,3,5,6,7-hexahydropyrrolizine |
|---|---|
| PubChem CID | 170726733 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | 8-(prop-1-en-2-yloxymethyl)-1,2,3,5,6,7-hexahydropyrrolizine |
| SMILES | C=C(C)OCC12CCCN1CCC2 |
| InChI | InChI=1S/C11H19NO/c1-10(2)13-9-11-5-3-7-12(11)8-4-6-11/h1,3-9H2,2H3 |
| InChIKey | QQZJKQRSPXZRIG-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|