C12H21N3O — CID 167215178
1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethyl N'-[(Z)-prop-1-enyl]carbamimidate (PubChem CID 167215178) has the molecular formula C12H21N3O and a molecular weight of 223.32 g/mol. Its IUPAC name is 1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethyl N'-[(Z)-prop-1-enyl]carbamimidate.
| Compound Name | 1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethyl N'-[(Z)-prop-1-enyl]carbamimidate |
|---|---|
| PubChem CID | 167215178 |
| Molecular Formula | C12H21N3O |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | 1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethyl N'-[(Z)-prop-1-enyl]carbamimidate |
| SMILES | C/C=C\N=C(/N)OCC12CCCN1CCC2 |
| InChI | InChI=1S/C12H21N3O/c1-2-7-14-11(13)16-10-12-5-3-8-15(12)9-4-6-12/h2,7H,3-6,8-10H2,1H3,(H2,13,14)/b7-2- |
| InChIKey | RTMLEKDQXPKKKT-UQCOIBPSSA-N |
| XLogP | 1.48 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|