C8H15NOS2 — CID 170423133
8-(disulfanyloxymethyl)-1,2,3,5,6,7-hexahydropyrrolizine (PubChem CID 170423133) has the molecular formula C8H15NOS2 and a molecular weight of 205.35 g/mol. Its IUPAC name is 8-(disulfanyloxymethyl)-1,2,3,5,6,7-hexahydropyrrolizine.
| Compound Name | 8-(disulfanyloxymethyl)-1,2,3,5,6,7-hexahydropyrrolizine |
|---|---|
| PubChem CID | 170423133 |
| Molecular Formula | C8H15NOS2 |
| Molecular Weight | 205.35 g/mol |
| Exact Mass | 205.06 |
| IUPAC Name | 8-(disulfanyloxymethyl)-1,2,3,5,6,7-hexahydropyrrolizine |
| SMILES | SSOCC12CCCN1CCC2 |
| InChI | InChI=1S/C8H15NOS2/c11-12-10-7-8-3-1-5-9(8)6-2-4-8/h11H,1-7H2 |
| InChIKey | IKAYHJWJIJMFQQ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 12.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.35 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|