C9H16NORb — CID 176714593
(8S)-8-(methoxymethyl)-1,2,3,5,6,7-hexahydropyrrolizin-6-ide;rubidium(1+) (PubChem CID 176714593) has the molecular formula C9H16NORb and a molecular weight of 239.70 g/mol. Its IUPAC name is (8S)-8-(methoxymethyl)-1,2,3,5,6,7-hexahydropyrrolizin-6-ide;rubidium(1+).
| Compound Name | (8S)-8-(methoxymethyl)-1,2,3,5,6,7-hexahydropyrrolizin-6-ide;rubidium(1+) |
|---|---|
| PubChem CID | 176714593 |
| Molecular Formula | C9H16NORb |
| Molecular Weight | 239.70 g/mol |
| Exact Mass | 239.03 |
| IUPAC Name | (8S)-8-(methoxymethyl)-1,2,3,5,6,7-hexahydropyrrolizin-6-ide;rubidium(1+) |
| SMILES | COC[C@@]12C[CH-]CN1CCC2.[Rb+] |
| InChI | InChI=1S/C9H16NO.Rb/c1-11-8-9-4-2-6-10(9)7-3-5-9;/h2H,3-8H2,1H3;/q-1;+1/t9-;/m0./s1 |
| InChIKey | JJRBDRQAGDFLOZ-FVGYRXGTSA-N |
| XLogP | -1.92 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.70 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|