C23H37FN2O2 — CID 170219901
(8S)-8-(ethoxymethyl)-5-[2-[[(6Z,8S)-6-(fluoromethylidene)-2,3,5,7-tetrahydro-1H-pyrrolizin-8-yl]methoxy]propyl]-6-methylidene-2,3,5,7-tetrahydro-1H-pyrrolizine (PubChem CID 170219901) has the molecular formula C23H37FN2O2 and a molecular weight of 392.56 g/mol. Its IUPAC name is (8S)-8-(ethoxymethyl)-5-[2-[[(6Z,8S)-6-(fluoromethylidene)-2,3,5,7-tetrahydro-1H-pyrrolizin-8-yl]methoxy]propyl]-6-methylidene-2,3,5,7-tetrahydro-1H-pyrrolizine.
| Compound Name | (8S)-8-(ethoxymethyl)-5-[2-[[(6Z,8S)-6-(fluoromethylidene)-2,3,5,7-tetrahydro-1H-pyrrolizin-8-yl]methoxy]propyl]-6-methylidene-2,3,5,7-tetrahydro-1H-pyrrolizine |
|---|---|
| PubChem CID | 170219901 |
| Molecular Formula | C23H37FN2O2 |
| Molecular Weight | 392.56 g/mol |
| Exact Mass | 392.28 |
| IUPAC Name | (8S)-8-(ethoxymethyl)-5-[2-[[(6Z,8S)-6-(fluoromethylidene)-2,3,5,7-tetrahydro-1H-pyrrolizin-8-yl]methoxy]propyl]-6-methylidene-2,3,5,7-tetrahydro-1H-pyrrolizine |
| SMILES | C=C1C[C@]2(COCC)CCCN2C1CC(C)OC[C@@]12CCCN1C/C(=C\F)C2 |
| InChI | InChI=1S/C23H37FN2O2/c1-4-27-16-23-8-6-10-26(23)21(18(2)12-23)11-19(3)28-17-22-7-5-9-25(22)15-20(13-22)14-24/h14,19,21H,2,4-13,15-17H2,1,3H3/b20-14-/t19?,21?,22-,23-/m0/s1 |
| InChIKey | BHFJUFCCSRVHBP-CJPMBPMXSA-N |
| XLogP | 4.07 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.56 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|