C10H13N — CID 169448378
8-ethynyl-6-methylidene-2,3,5,7-tetrahydro-1H-pyrrolizine (PubChem CID 169448378) has the molecular formula C10H13N and a molecular weight of 147.22 g/mol. Its IUPAC name is 8-ethynyl-6-methylidene-2,3,5,7-tetrahydro-1H-pyrrolizine.
| Compound Name | 8-ethynyl-6-methylidene-2,3,5,7-tetrahydro-1H-pyrrolizine |
|---|---|
| PubChem CID | 169448378 |
| Molecular Formula | C10H13N |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.10 |
| IUPAC Name | 8-ethynyl-6-methylidene-2,3,5,7-tetrahydro-1H-pyrrolizine |
| SMILES | C#CC12CCCN1CC(=C)C2 |
| InChI | InChI=1S/C10H13N/c1-3-10-5-4-6-11(10)8-9(2)7-10/h1H,2,4-8H2 |
| InChIKey | OHGANIUAEMAXSR-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|