C9H15NO — CID 163984751
6-methyl-4-methylidene-2,3,4a,5,7,7a-hexahydropyrano[2,3-c]pyrrole (PubChem CID 163984751) has the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. Its IUPAC name is 6-methyl-4-methylidene-2,3,4a,5,7,7a-hexahydropyrano[2,3-c]pyrrole.
| Compound Name | 6-methyl-4-methylidene-2,3,4a,5,7,7a-hexahydropyrano[2,3-c]pyrrole |
|---|---|
| PubChem CID | 163984751 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | 6-methyl-4-methylidene-2,3,4a,5,7,7a-hexahydropyrano[2,3-c]pyrrole |
| SMILES | C=C1CCOC2CN(C)CC12 |
| InChI | InChI=1S/C9H15NO/c1-7-3-4-11-9-6-10(2)5-8(7)9/h8-9H,1,3-6H2,2H3 |
| InChIKey | TVGYWLFOLVQYDH-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|