C27H37N4O3P — CID 123684277
[(Z)-1-[4-[[[2-amino-4-(1-phosphanylpiperidin-4-yl)butanoyl]amino]methyl]phenyl]butylideneamino] benzoate (PubChem CID 123684277) has the molecular formula C27H37N4O3P and a molecular weight of 496.59 g/mol. Its IUPAC name is [(Z)-1-[4-[[[2-amino-4-(1-phosphanylpiperidin-4-yl)butanoyl]amino]methyl]phenyl]butylideneamino] benzoate.
| Compound Name | [(Z)-1-[4-[[[2-amino-4-(1-phosphanylpiperidin-4-yl)butanoyl]amino]methyl]phenyl]butylideneamino] benzoate |
|---|---|
| PubChem CID | 123684277 |
| Molecular Formula | C27H37N4O3P |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.26 |
| IUPAC Name | [(Z)-1-[4-[[[2-amino-4-(1-phosphanylpiperidin-4-yl)butanoyl]amino]methyl]phenyl]butylideneamino] benzoate |
| SMILES | CCC/C(=N/OC(=O)c1ccccc1)c1ccc(CNC(=O)C(N)CCC2CCN(P)CC2)cc1 |
| InChI | InChI=1S/C27H37N4O3P/c1-2-6-25(30-34-27(33)23-7-4-3-5-8-23)22-12-9-21(10-13-22)19-29-26(32)24(28)14-11-20-15-17-31(35)18-16-20/h3-5,7-10,12-13,20,24H,2,6,11,14-19,28,35H2,1H3,(H,29,32)/b30-25- |
| InChIKey | RXKRGLXLZSWCQK-JVCXMKTPSA-N |
| XLogP | 4.27 |
| TPSA | 97.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|