C24H34N5O2P — CID 123811787
2-amino-N-[[4-(N'-phenylmethoxycarbamimidoyl)phenyl]methyl]-4-(1-phosphanylpiperidin-4-yl)butanamide (PubChem CID 123811787) has the molecular formula C24H34N5O2P and a molecular weight of 455.54 g/mol. Its IUPAC name is 2-amino-N-[[4-(N'-phenylmethoxycarbamimidoyl)phenyl]methyl]-4-(1-phosphanylpiperidin-4-yl)butanamide.
| Compound Name | 2-amino-N-[[4-(N'-phenylmethoxycarbamimidoyl)phenyl]methyl]-4-(1-phosphanylpiperidin-4-yl)butanamide |
|---|---|
| PubChem CID | 123811787 |
| Molecular Formula | C24H34N5O2P |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.25 |
| IUPAC Name | 2-amino-N-[[4-(N'-phenylmethoxycarbamimidoyl)phenyl]methyl]-4-(1-phosphanylpiperidin-4-yl)butanamide |
| SMILES | NC(=NOCc1ccccc1)c1ccc(CNC(=O)C(N)CCC2CCN(P)CC2)cc1 |
| InChI | InChI=1S/C24H34N5O2P/c25-22(11-8-18-12-14-29(32)15-13-18)24(30)27-16-19-6-9-21(10-7-19)23(26)28-31-17-20-4-2-1-3-5-20/h1-7,9-10,18,22H,8,11-17,25,32H2,(H2,26,28)(H,27,30) |
| InChIKey | AYTDJWYNHILDIJ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 105.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|