C18H16F2N4O2S — CID 123684441
6-(4-fluoro-2-methoxyphenyl)-N-[6-fluoro-4-(methylsulfinylmethyl)-2-pyridinyl]pyrimidin-4-amine (PubChem CID 123684441) has the molecular formula C18H16F2N4O2S and a molecular weight of 390.42 g/mol. Its IUPAC name is 6-(4-fluoro-2-methoxyphenyl)-N-[6-fluoro-4-(methylsulfinylmethyl)-2-pyridinyl]pyrimidin-4-amine.
| Compound Name | 6-(4-fluoro-2-methoxyphenyl)-N-[6-fluoro-4-(methylsulfinylmethyl)-2-pyridinyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 123684441 |
| Molecular Formula | C18H16F2N4O2S |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | 6-(4-fluoro-2-methoxyphenyl)-N-[6-fluoro-4-(methylsulfinylmethyl)-2-pyridinyl]pyrimidin-4-amine |
| SMILES | COc1cc(F)ccc1-c1cc(Nc2cc(CS(C)=O)cc(F)n2)ncn1 |
| InChI | InChI=1S/C18H16F2N4O2S/c1-26-15-7-12(19)3-4-13(15)14-8-17(22-10-21-14)24-18-6-11(9-27(2)25)5-16(20)23-18/h3-8,10H,9H2,1-2H3,(H,21,22,23,24) |
| InChIKey | UGJDOGOCRQYRBW-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|