C18H17FN4O3S — CID 67609910
N-[3-[[6-(4-fluoro-2-methoxyphenyl)pyrimidin-4-yl]amino]phenyl]methanesulfonamide (PubChem CID 67609910) has the molecular formula C18H17FN4O3S and a molecular weight of 388.42 g/mol. Its IUPAC name is N-[3-[[6-(4-fluoro-2-methoxyphenyl)pyrimidin-4-yl]amino]phenyl]methanesulfonamide.
| Compound Name | N-[3-[[6-(4-fluoro-2-methoxyphenyl)pyrimidin-4-yl]amino]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 67609910 |
| Molecular Formula | C18H17FN4O3S |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | N-[3-[[6-(4-fluoro-2-methoxyphenyl)pyrimidin-4-yl]amino]phenyl]methanesulfonamide |
| SMILES | COc1cc(F)ccc1-c1cc(Nc2cccc(NS(C)(=O)=O)c2)ncn1 |
| InChI | InChI=1S/C18H17FN4O3S/c1-26-17-8-12(19)6-7-15(17)16-10-18(21-11-20-16)22-13-4-3-5-14(9-13)23-27(2,24)25/h3-11,23H,1-2H3,(H,20,21,22) |
| InChIKey | WWGNFQKREMQOMC-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |