C10H16N2 — CID 123685184
[(4Z)-4-ethylidene-2-methylhepta-2,5-dien-3-yl]diazene (PubChem CID 123685184) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is [(4Z)-4-ethylidene-2-methylhepta-2,5-dien-3-yl]diazene.
| Compound Name | [(4Z)-4-ethylidene-2-methylhepta-2,5-dien-3-yl]diazene |
|---|---|
| PubChem CID | 123685184 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | [(4Z)-4-ethylidene-2-methylhepta-2,5-dien-3-yl]diazene |
| SMILES | [H]/N=N/C(=C(C)C)/C(C=CC)=C\C |
| InChI | InChI=1S/C10H16N2/c1-5-7-9(6-2)10(12-11)8(3)4/h5-7,11H,1-4H3/b7-5?,9-6-,12-11+ |
| InChIKey | RRHQKCJULXJVBN-HPTKLFNKSA-N |
| XLogP | 3.83 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|