C25H26N6O3 — CID 123685764
6-[2-[4-[3-[[4-(tetrazol-1-yl)phenyl]methyl]oxiran-2-yl]piperazin-1-yl]ethyl]isochromen-1-one (PubChem CID 123685764) has the molecular formula C25H26N6O3 and a molecular weight of 458.52 g/mol. Its IUPAC name is 6-[2-[4-[3-[[4-(tetrazol-1-yl)phenyl]methyl]oxiran-2-yl]piperazin-1-yl]ethyl]isochromen-1-one.
| Compound Name | 6-[2-[4-[3-[[4-(tetrazol-1-yl)phenyl]methyl]oxiran-2-yl]piperazin-1-yl]ethyl]isochromen-1-one |
|---|---|
| PubChem CID | 123685764 |
| Molecular Formula | C25H26N6O3 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.21 |
| IUPAC Name | 6-[2-[4-[3-[[4-(tetrazol-1-yl)phenyl]methyl]oxiran-2-yl]piperazin-1-yl]ethyl]isochromen-1-one |
| SMILES | O=c1occc2cc(CCN3CCN(C4OC4Cc4ccc(-n5cnnn5)cc4)CC3)ccc12 |
| InChI | InChI=1S/C25H26N6O3/c32-25-22-6-3-19(15-20(22)8-14-33-25)7-9-29-10-12-30(13-11-29)24-23(34-24)16-18-1-4-21(5-2-18)31-17-26-27-28-31/h1-6,8,14-15,17,23-24H,7,9-13,16H2 |
| InChIKey | LZKRNLCGGOKXFY-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 92.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|