C16H22O7 — CID 123686092
(8Z)-8-ethylidene-7-hydroxy-4,5-dioxo-3-propylcyclononane-1,2-dicarboxylic acid (PubChem CID 123686092) has the molecular formula C16H22O7 and a molecular weight of 326.35 g/mol. Its IUPAC name is (8Z)-8-ethylidene-7-hydroxy-4,5-dioxo-3-propylcyclononane-1,2-dicarboxylic acid.
| Compound Name | (8Z)-8-ethylidene-7-hydroxy-4,5-dioxo-3-propylcyclononane-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 123686092 |
| Molecular Formula | C16H22O7 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | (8Z)-8-ethylidene-7-hydroxy-4,5-dioxo-3-propylcyclononane-1,2-dicarboxylic acid |
| SMILES | C/C=C1/CC(C(=O)O)C(C(=O)O)C(CCC)C(=O)C(=O)CC1O |
| InChI | InChI=1S/C16H22O7/c1-3-5-9-13(16(22)23)10(15(20)21)6-8(4-2)11(17)7-12(18)14(9)19/h4,9-11,13,17H,3,5-7H2,1-2H3,(H,20,21)(H,22,23)/b8-4- |
| InChIKey | FEVMWCIOSPVHEI-YWEYNIOJSA-N |
| XLogP | 1.04 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|