C12H21B3NO3 — CID 159316177
CID 159316177 (PubChem CID 159316177) has the molecular formula C12H21B3NO3 and a molecular weight of 259.74 g/mol.
| Compound Name | CID 159316177 |
|---|---|
| PubChem CID | 159316177 |
| Molecular Formula | C12H21B3NO3 |
| Molecular Weight | 259.74 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | — |
| SMILES | CCCCN1CC(C(=O)O)C(CCC)C1=O.[B][B][B] |
| InChI | InChI=1S/C12H21NO3.B3/c1-3-5-7-13-8-10(12(15)16)9(6-4-2)11(13)14;1-3-2/h9-10H,3-8H2,1-2H3,(H,15,16); |
| InChIKey | DFTPAVSDMQJDFN-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.74 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|