C9H17NO4 — CID 101481394
(3R,4R,5R)-1-butyl-3,4,5-trihydroxypiperidin-2-one (PubChem CID 101481394) has the molecular formula C9H17NO4 and a molecular weight of 203.24 g/mol. Its IUPAC name is (3R,4R,5R)-1-butyl-3,4,5-trihydroxypiperidin-2-one.
| Compound Name | (3R,4R,5R)-1-butyl-3,4,5-trihydroxypiperidin-2-one |
|---|---|
| PubChem CID | 101481394 |
| Molecular Formula | C9H17NO4 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | (3R,4R,5R)-1-butyl-3,4,5-trihydroxypiperidin-2-one |
| SMILES | CCCCN1C[C@@H](O)[C@@H](O)[C@@H](O)C1=O |
| InChI | InChI=1S/C9H17NO4/c1-2-3-4-10-5-6(11)7(12)8(13)9(10)14/h6-8,11-13H,2-5H2,1H3/t6-,7-,8-/m1/s1 |
| InChIKey | ARXCYPVZALWGFA-BWZBUEFSSA-N |
| XLogP | -1.29 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |