C15H30N2O4Si — CID 173404389
4-butyl-1-[2-(3-methoxysilylpropylamino)ethyl]-5-oxopyrrolidine-3-carboxylic acid (PubChem CID 173404389) has the molecular formula C15H30N2O4Si and a molecular weight of 330.50 g/mol. Its IUPAC name is 4-butyl-1-[2-(3-methoxysilylpropylamino)ethyl]-5-oxopyrrolidine-3-carboxylic acid.
| Compound Name | 4-butyl-1-[2-(3-methoxysilylpropylamino)ethyl]-5-oxopyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 173404389 |
| Molecular Formula | C15H30N2O4Si |
| Molecular Weight | 330.50 g/mol |
| Exact Mass | 330.20 |
| IUPAC Name | 4-butyl-1-[2-(3-methoxysilylpropylamino)ethyl]-5-oxopyrrolidine-3-carboxylic acid |
| SMILES | CCCCC1C(=O)N(CCNCCC[SiH2]OC)CC1C(=O)O |
| InChI | InChI=1S/C15H30N2O4Si/c1-3-4-6-12-13(15(19)20)11-17(14(12)18)9-8-16-7-5-10-22-21-2/h12-13,16H,3-11,22H2,1-2H3,(H,19,20) |
| InChIKey | GFAIXUFMYAWPLS-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.50 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|