About 4-cyclopropyl-5-oxo-1-pentylpyrrolidine-3-carboxylic acid;molecular hydrogen
4-cyclopropyl-5-oxo-1-pentylpyrrolidine-3-carboxylic acid;molecular hydrogen (PubChem CID 161111935) has the molecular formula C13H25NO3
and a molecular weight of 243.35 g/mol. Its IUPAC name is 4-cyclopropyl-5-oxo-1-pentylpyrrolidine-3-carboxylic acid;molecular hydrogen.
Molecular Properties
| Compound Name | 4-cyclopropyl-5-oxo-1-pentylpyrrolidine-3-carboxylic acid;molecular hydrogen |
| PubChem CID | 161111935 |
| Molecular Formula | C13H25NO3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.18 |
| IUPAC Name | 4-cyclopropyl-5-oxo-1-pentylpyrrolidine-3-carboxylic acid;molecular hydrogen |
| SMILES | CCCCCN1CC(C(=O)O)C(C2CC2)C1=O.[H][H].[H][H] |
| InChI | InChI=1S/C13H21NO3.2H2/c1-2-3-4-7-14-8-10(13(16)17)11(12(14)15)9-5-6-9;;/h9-11H,2-8H2,1H3,(H,16,17);2*1H |
| InChIKey | UJUPOLWSAHUXQX-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-cyclopropyl-5-oxo-1-pentylpyrrolidine-3-carboxylic acid;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclopropyl-5-oxo-1-pentylpyrrolidine-3-carboxylic acid;molecular hydrogen?
The IUPAC name of 4-cyclopropyl-5-oxo-1-pentylpyrrolidine-3-carboxylic acid;molecular hydrogen (CID 161111935) is 4-cyclopropyl-5-oxo-1-pentylpyrrolidine-3-carboxylic acid;molecular hydrogen.
What is the SMILES notation for 4-cyclopropyl-5-oxo-1-pentylpyrrolidine-3-carboxylic acid;molecular hydrogen?
The canonical SMILES for 4-cyclopropyl-5-oxo-1-pentylpyrrolidine-3-carboxylic acid;molecular hydrogen is CCCCCN1CC(C(=O)O)C(C2CC2)C1=O.[H][H].[H][H].
What is the InChIKey of 4-cyclopropyl-5-oxo-1-pentylpyrrolidine-3-carboxylic acid;molecular hydrogen?
The InChIKey is UJUPOLWSAHUXQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21NO3.2H2/c1-2-3-4-7-14-8-10(13(16)17)11(12(14)15)9-5-6-9;;/h9-11H,2-8H2,1H3,(H,16,17);2*1H.
What are the key properties of 4-cyclopropyl-5-oxo-1-pentylpyrrolidine-3-carboxylic acid;molecular hydrogen?
4-cyclopropyl-5-oxo-1-pentylpyrrolidine-3-carboxylic acid;molecular hydrogen has a molecular weight of 243.35 g/mol, XLogP of 2.24, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclopropyl-5-oxo-1-pentylpyrrolidine-3-carboxylic acid;molecular hydrogen is sourced from PubChem (CID 161111935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).