C17H22ClN3O4 — CID 67792610
(3R,4R)-4-[(4-chlorophenyl)carbamoylamino]-5-oxo-1-pentylpyrrolidine-3-carboxylic acid (PubChem CID 67792610) has the molecular formula C17H22ClN3O4 and a molecular weight of 367.83 g/mol. Its IUPAC name is (3R,4R)-4-[(4-chlorophenyl)carbamoylamino]-5-oxo-1-pentylpyrrolidine-3-carboxylic acid.
| Compound Name | (3R,4R)-4-[(4-chlorophenyl)carbamoylamino]-5-oxo-1-pentylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 67792610 |
| Molecular Formula | C17H22ClN3O4 |
| Molecular Weight | 367.83 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | (3R,4R)-4-[(4-chlorophenyl)carbamoylamino]-5-oxo-1-pentylpyrrolidine-3-carboxylic acid |
| SMILES | CCCCCN1C[C@@H](C(=O)O)[C@@H](NC(=O)Nc2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C17H22ClN3O4/c1-2-3-4-9-21-10-13(16(23)24)14(15(21)22)20-17(25)19-12-7-5-11(18)6-8-12/h5-8,13-14H,2-4,9-10H2,1H3,(H,23,24)(H2,19,20,25)/t13-,14-/m1/s1 |
| InChIKey | AJUUEVKYJILXJS-ZIAGYGMSSA-N |
| XLogP | 2.56 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.83 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|