C25H33N3O4 — CID 67795325
tert-butyl (3S,4S)-4-(naphthalen-2-ylcarbamoylamino)-5-oxo-1-pentylpyrrolidine-3-carboxylate (PubChem CID 67795325) has the molecular formula C25H33N3O4 and a molecular weight of 439.56 g/mol. Its IUPAC name is tert-butyl (3S,4S)-4-(naphthalen-2-ylcarbamoylamino)-5-oxo-1-pentylpyrrolidine-3-carboxylate.
| Compound Name | tert-butyl (3S,4S)-4-(naphthalen-2-ylcarbamoylamino)-5-oxo-1-pentylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 67795325 |
| Molecular Formula | C25H33N3O4 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | tert-butyl (3S,4S)-4-(naphthalen-2-ylcarbamoylamino)-5-oxo-1-pentylpyrrolidine-3-carboxylate |
| SMILES | CCCCCN1C[C@H](C(=O)OC(C)(C)C)[C@H](NC(=O)Nc2ccc3ccccc3c2)C1=O |
| InChI | InChI=1S/C25H33N3O4/c1-5-6-9-14-28-16-20(23(30)32-25(2,3)4)21(22(28)29)27-24(31)26-19-13-12-17-10-7-8-11-18(17)15-19/h7-8,10-13,15,20-21H,5-6,9,14,16H2,1-4H3,(H2,26,27,31)/t20-,21-/m0/s1 |
| InChIKey | FSQWCZWHFYQTLH-SFTDATJTSA-N |
| XLogP | 4.32 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|