C28H45N5O2 — CID 166712489
1-[1-decyl-4-(2-hydroxyethylamino)-6-methyl-1,3-diazinan-2-yl]-3-naphthalen-2-ylurea (PubChem CID 166712489) has the molecular formula C28H45N5O2 and a molecular weight of 483.70 g/mol. Its IUPAC name is 1-[1-decyl-4-(2-hydroxyethylamino)-6-methyl-1,3-diazinan-2-yl]-3-naphthalen-2-ylurea.
| Compound Name | 1-[1-decyl-4-(2-hydroxyethylamino)-6-methyl-1,3-diazinan-2-yl]-3-naphthalen-2-ylurea |
|---|---|
| PubChem CID | 166712489 |
| Molecular Formula | C28H45N5O2 |
| Molecular Weight | 483.70 g/mol |
| Exact Mass | 483.36 |
| IUPAC Name | 1-[1-decyl-4-(2-hydroxyethylamino)-6-methyl-1,3-diazinan-2-yl]-3-naphthalen-2-ylurea |
| SMILES | CCCCCCCCCCN1C(C)CC(NCCO)NC1NC(=O)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C28H45N5O2/c1-3-4-5-6-7-8-9-12-18-33-22(2)20-26(29-17-19-34)31-27(33)32-28(35)30-25-16-15-23-13-10-11-14-24(23)21-25/h10-11,13-16,21-22,26-27,29,31,34H,3-9,12,17-20H2,1-2H3,(H2,30,32,35) |
| InChIKey | NEACIYGUHRJBAF-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 88.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.70 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|