C20H28N6O — CID 166712523
1-[3,6-dimethyl-4-[2-(methylamino)ethylamino]-4,5-dihydro-2H-pyrimidin-2-yl]-3-naphthalen-2-ylurea (PubChem CID 166712523) has the molecular formula C20H28N6O and a molecular weight of 368.49 g/mol. Its IUPAC name is 1-[3,6-dimethyl-4-[2-(methylamino)ethylamino]-4,5-dihydro-2H-pyrimidin-2-yl]-3-naphthalen-2-ylurea.
| Compound Name | 1-[3,6-dimethyl-4-[2-(methylamino)ethylamino]-4,5-dihydro-2H-pyrimidin-2-yl]-3-naphthalen-2-ylurea |
|---|---|
| PubChem CID | 166712523 |
| Molecular Formula | C20H28N6O |
| Molecular Weight | 368.49 g/mol |
| Exact Mass | 368.23 |
| IUPAC Name | 1-[3,6-dimethyl-4-[2-(methylamino)ethylamino]-4,5-dihydro-2H-pyrimidin-2-yl]-3-naphthalen-2-ylurea |
| SMILES | CNCCNC1CC(C)=NC(NC(=O)Nc2ccc3ccccc3c2)N1C |
| InChI | InChI=1S/C20H28N6O/c1-14-12-18(22-11-10-21-2)26(3)19(23-14)25-20(27)24-17-9-8-15-6-4-5-7-16(15)13-17/h4-9,13,18-19,21-22H,10-12H2,1-3H3,(H2,24,25,27) |
| InChIKey | WJWGPFFJACTSNN-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 80.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.49 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|