C27H32F2N4O3S — CID 123687326
N-[[2-[[5-fluoro-4-(4-fluoro-2-methoxyphenyl)-2-pyridinyl]amino]-4-pyridinyl]methylidene-methyl-oxo-λ6-sulfanyl]-2,3-dimethylhexanamide (PubChem CID 123687326) has the molecular formula C27H32F2N4O3S and a molecular weight of 530.64 g/mol. Its IUPAC name is N-[[2-[[5-fluoro-4-(4-fluoro-2-methoxyphenyl)-2-pyridinyl]amino]-4-pyridinyl]methylidene-methyl-oxo-λ6-sulfanyl]-2,3-dimethylhexanamide.
| Compound Name | N-[[2-[[5-fluoro-4-(4-fluoro-2-methoxyphenyl)-2-pyridinyl]amino]-4-pyridinyl]methylidene-methyl-oxo-λ6-sulfanyl]-2,3-dimethylhexanamide |
|---|---|
| PubChem CID | 123687326 |
| Molecular Formula | C27H32F2N4O3S |
| Molecular Weight | 530.64 g/mol |
| Exact Mass | 530.22 |
| IUPAC Name | N-[[2-[[5-fluoro-4-(4-fluoro-2-methoxyphenyl)-2-pyridinyl]amino]-4-pyridinyl]methylidene-methyl-oxo-λ6-sulfanyl]-2,3-dimethylhexanamide |
| SMILES | CCCC(C)C(C)C(=O)NS(C)(=O)=Cc1ccnc(Nc2cc(-c3ccc(F)cc3OC)c(F)cn2)c1 |
| InChI | InChI=1S/C27H32F2N4O3S/c1-6-7-17(2)18(3)27(34)33-37(5,35)16-19-10-11-30-25(12-19)32-26-14-22(23(29)15-31-26)21-9-8-20(28)13-24(21)36-4/h8-18H,6-7H2,1-5H3,(H,30,31,32)(H,33,34,35) |
| InChIKey | UZNZQTCQPLSJCN-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.64 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|