C21H21F2N5O3S — CID 123960177
1-[[3-[[5-fluoro-4-(4-fluoro-2-methoxyphenyl)pyrimidin-2-yl]amino]phenyl]methylidene-methyl-oxo-λ6-sulfanyl]-3-methylurea (PubChem CID 123960177) has the molecular formula C21H21F2N5O3S and a molecular weight of 461.49 g/mol. Its IUPAC name is 1-[[3-[[5-fluoro-4-(4-fluoro-2-methoxyphenyl)pyrimidin-2-yl]amino]phenyl]methylidene-methyl-oxo-λ6-sulfanyl]-3-methylurea.
| Compound Name | 1-[[3-[[5-fluoro-4-(4-fluoro-2-methoxyphenyl)pyrimidin-2-yl]amino]phenyl]methylidene-methyl-oxo-λ6-sulfanyl]-3-methylurea |
|---|---|
| PubChem CID | 123960177 |
| Molecular Formula | C21H21F2N5O3S |
| Molecular Weight | 461.49 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | 1-[[3-[[5-fluoro-4-(4-fluoro-2-methoxyphenyl)pyrimidin-2-yl]amino]phenyl]methylidene-methyl-oxo-λ6-sulfanyl]-3-methylurea |
| SMILES | CNC(=O)NS(C)(=O)=Cc1cccc(Nc2ncc(F)c(-c3ccc(F)cc3OC)n2)c1 |
| InChI | InChI=1S/C21H21F2N5O3S/c1-24-21(29)28-32(3,30)12-13-5-4-6-15(9-13)26-20-25-11-17(23)19(27-20)16-8-7-14(22)10-18(16)31-2/h4-12H,1-3H3,(H,25,26,27)(H2,24,28,29,30) |
| InChIKey | YVYDYRFKPCENNN-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 105.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.49 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|