C14H21N3 — CID 123687493
N-[(4-cyclohexa-1,3-dien-1-yl-5-methyl-1H-imidazol-2-yl)methyl]propan-1-amine (PubChem CID 123687493) has the molecular formula C14H21N3 and a molecular weight of 231.34 g/mol. Its IUPAC name is N-[(4-cyclohexa-1,3-dien-1-yl-5-methyl-1H-imidazol-2-yl)methyl]propan-1-amine.
| Compound Name | N-[(4-cyclohexa-1,3-dien-1-yl-5-methyl-1H-imidazol-2-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 123687493 |
| Molecular Formula | C14H21N3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | N-[(4-cyclohexa-1,3-dien-1-yl-5-methyl-1H-imidazol-2-yl)methyl]propan-1-amine |
| SMILES | CCCNCc1nc(C2=CC=CCC2)c(C)[nH]1 |
| InChI | InChI=1S/C14H21N3/c1-3-9-15-10-13-16-11(2)14(17-13)12-7-5-4-6-8-12/h4-5,7,15H,3,6,8-10H2,1-2H3,(H,16,17) |
| InChIKey | UMVAXXHUTFWDGZ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|