C24H31N5O4 — CID 123688133
1-[3-[4-(2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-ylamino)-1-propan-2-ylpyrazolo[5,4-b]pyridin-6-yl]phenoxy]-3-aminopropan-2-ol (PubChem CID 123688133) has the molecular formula C24H31N5O4 and a molecular weight of 453.54 g/mol. Its IUPAC name is 1-[3-[4-(2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-ylamino)-1-propan-2-ylpyrazolo[5,4-b]pyridin-6-yl]phenoxy]-3-aminopropan-2-ol.
| Compound Name | 1-[3-[4-(2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-ylamino)-1-propan-2-ylpyrazolo[5,4-b]pyridin-6-yl]phenoxy]-3-aminopropan-2-ol |
|---|---|
| PubChem CID | 123688133 |
| Molecular Formula | C24H31N5O4 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.24 |
| IUPAC Name | 1-[3-[4-(2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-ylamino)-1-propan-2-ylpyrazolo[5,4-b]pyridin-6-yl]phenoxy]-3-aminopropan-2-ol |
| SMILES | CC(C)n1ncc2c(NC3COC4OCCC34)cc(-c3cccc(OCC(O)CN)c3)nc21 |
| InChI | InChI=1S/C24H31N5O4/c1-14(2)29-23-19(11-26-29)21(27-22-13-33-24-18(22)6-7-31-24)9-20(28-23)15-4-3-5-17(8-15)32-12-16(30)10-25/h3-5,8-9,11,14,16,18,22,24,30H,6-7,10,12-13,25H2,1-2H3,(H,27,28) |
| InChIKey | MVSRPCGOVFQFTB-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 116.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |