C6H8N2O — CID 123691408
5,6-dimethyl-1H-pyridazin-4-one (PubChem CID 123691408) has the molecular formula C6H8N2O and a molecular weight of 124.14 g/mol. Its IUPAC name is 5,6-dimethyl-1H-pyridazin-4-one.
| Compound Name | 5,6-dimethyl-1H-pyridazin-4-one |
|---|---|
| PubChem CID | 123691408 |
| Molecular Formula | C6H8N2O |
| Molecular Weight | 124.14 g/mol |
| Exact Mass | 124.06 |
| IUPAC Name | 5,6-dimethyl-1H-pyridazin-4-one |
| SMILES | Cc1[nH]ncc(=O)c1C |
| InChI | InChI=1S/C6H8N2O/c1-4-5(2)8-7-3-6(4)9/h3H,1-2H3,(H,8,9) |
| InChIKey | KKVFWRFMHGPVLO-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.14 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |