About 2,3-dimethyl-1,5-dihydropyrrolo[2,3-d]pyridazin-4-one
2,3-dimethyl-1,5-dihydropyrrolo[2,3-d]pyridazin-4-one (PubChem CID 143506915) has the molecular formula C8H9N3O
and a molecular weight of 163.18 g/mol. Its IUPAC name is 2,3-dimethyl-1,5-dihydropyrrolo[2,3-d]pyridazin-4-one.
Analyze 2,3-dimethyl-1,5-dihydropyrrolo[2,3-d]pyridazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethyl-1,5-dihydropyrrolo[2,3-d]pyridazin-4-one?
The IUPAC name of 2,3-dimethyl-1,5-dihydropyrrolo[2,3-d]pyridazin-4-one (CID 143506915) is 2,3-dimethyl-1,5-dihydropyrrolo[2,3-d]pyridazin-4-one.
What is the SMILES notation for 2,3-dimethyl-1,5-dihydropyrrolo[2,3-d]pyridazin-4-one?
The canonical SMILES for 2,3-dimethyl-1,5-dihydropyrrolo[2,3-d]pyridazin-4-one is Cc1[nH]c2cn[nH]c(=O)c2c1C.
What is the InChIKey of 2,3-dimethyl-1,5-dihydropyrrolo[2,3-d]pyridazin-4-one?
The InChIKey is IMODWJJURQMKHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3O/c1-4-5(2)10-6-3-9-11-8(12)7(4)6/h3,10H,1-2H3,(H,11,12).
What are the key properties of 2,3-dimethyl-1,5-dihydropyrrolo[2,3-d]pyridazin-4-one?
2,3-dimethyl-1,5-dihydropyrrolo[2,3-d]pyridazin-4-one has a molecular weight of 163.18 g/mol, XLogP of 0.87, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethyl-1,5-dihydropyrrolo[2,3-d]pyridazin-4-one is sourced from PubChem (CID 143506915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).