C10H19N — CID 91515820
ethane;2,3,4,5-tetramethyl-1H-pyrrole (PubChem CID 91515820) has the molecular formula C10H19N and a molecular weight of 153.27 g/mol. Its IUPAC name is ethane;2,3,4,5-tetramethyl-1H-pyrrole.
| Compound Name | ethane;2,3,4,5-tetramethyl-1H-pyrrole |
|---|---|
| PubChem CID | 91515820 |
| Molecular Formula | C10H19N |
| Molecular Weight | 153.27 g/mol |
| Exact Mass | 153.15 |
| IUPAC Name | ethane;2,3,4,5-tetramethyl-1H-pyrrole |
| SMILES | CC.Cc1[nH]c(C)c(C)c1C |
| InChI | InChI=1S/C8H13N.C2H6/c1-5-6(2)8(4)9-7(5)3;1-2/h9H,1-4H3;1-2H3 |
| InChIKey | YUDZMISYMJRUEY-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.27 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |