C15H20N2S — CID 134892863
bis(3,4,5-trimethyl-1H-pyrrol-2-yl)methanethione (PubChem CID 134892863) has the molecular formula C15H20N2S and a molecular weight of 260.41 g/mol. Its IUPAC name is bis(3,4,5-trimethyl-1H-pyrrol-2-yl)methanethione.
| Compound Name | bis(3,4,5-trimethyl-1H-pyrrol-2-yl)methanethione |
|---|---|
| PubChem CID | 134892863 |
| Molecular Formula | C15H20N2S |
| Molecular Weight | 260.41 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | bis(3,4,5-trimethyl-1H-pyrrol-2-yl)methanethione |
| SMILES | Cc1[nH]c(C(=S)c2[nH]c(C)c(C)c2C)c(C)c1C |
| InChI | InChI=1S/C15H20N2S/c1-7-9(3)13(16-11(7)5)15(18)14-10(4)8(2)12(6)17-14/h16-17H,1-6H3 |
| InChIKey | KZXRGPBXOTYTLV-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.41 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|