C25H29N5O3 — CID 123693530
7-[3-[2-(2-methoxyphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-3-oxoprop-1-enyl]-4-methyl-3,5-dihydro-1H-pyrido[2,3-e][1,4]diazepin-2-one (PubChem CID 123693530) has the molecular formula C25H29N5O3 and a molecular weight of 447.54 g/mol. Its IUPAC name is 7-[3-[2-(2-methoxyphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-3-oxoprop-1-enyl]-4-methyl-3,5-dihydro-1H-pyrido[2,3-e][1,4]diazepin-2-one.
| Compound Name | 7-[3-[2-(2-methoxyphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-3-oxoprop-1-enyl]-4-methyl-3,5-dihydro-1H-pyrido[2,3-e][1,4]diazepin-2-one |
|---|---|
| PubChem CID | 123693530 |
| Molecular Formula | C25H29N5O3 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | 7-[3-[2-(2-methoxyphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-3-oxoprop-1-enyl]-4-methyl-3,5-dihydro-1H-pyrido[2,3-e][1,4]diazepin-2-one |
| SMILES | COc1ccccc1N1CC2CN(C(=O)C=Cc3cnc4c(c3)CN(C)CC(=O)N4)CC2C1 |
| InChI | InChI=1S/C25H29N5O3/c1-28-11-18-9-17(10-26-25(18)27-23(31)16-28)7-8-24(32)30-14-19-12-29(13-20(19)15-30)21-5-3-4-6-22(21)33-2/h3-10,19-20H,11-16H2,1-2H3,(H,26,27,31) |
| InChIKey | COSUZGANBSCIKV-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|