C19H33NO7 — CID 123694728
N-butan-2-ylformamide;1-O-[2-(2-methylbutanoyloxy)ethyl] 4-O-prop-2-enyl butanedioate (PubChem CID 123694728) has the molecular formula C19H33NO7 and a molecular weight of 387.47 g/mol. Its IUPAC name is N-butan-2-ylformamide;1-O-[2-(2-methylbutanoyloxy)ethyl] 4-O-prop-2-enyl butanedioate.
| Compound Name | N-butan-2-ylformamide;1-O-[2-(2-methylbutanoyloxy)ethyl] 4-O-prop-2-enyl butanedioate |
|---|---|
| PubChem CID | 123694728 |
| Molecular Formula | C19H33NO7 |
| Molecular Weight | 387.47 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | N-butan-2-ylformamide;1-O-[2-(2-methylbutanoyloxy)ethyl] 4-O-prop-2-enyl butanedioate |
| SMILES | C=CCOC(=O)CCC(=O)OCCOC(=O)C(C)CC.CCC(C)NC=O |
| InChI | InChI=1S/C14H22O6.C5H11NO/c1-4-8-18-12(15)6-7-13(16)19-9-10-20-14(17)11(3)5-2;1-3-5(2)6-4-7/h4,11H,1,5-10H2,2-3H3;4-5H,3H2,1-2H3,(H,6,7) |
| InChIKey | CYFKQOGLTSZIOF-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.47 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|