C24H40N2O10 — CID 154606960
4-[2-[4-carboxy-2-(2-formamidopropyl)hexanoyl]oxyethoxycarbonyl]-2-ethyl-6-formamidoheptanoic acid (PubChem CID 154606960) has the molecular formula C24H40N2O10 and a molecular weight of 516.59 g/mol. Its IUPAC name is 4-[2-[4-carboxy-2-(2-formamidopropyl)hexanoyl]oxyethoxycarbonyl]-2-ethyl-6-formamidoheptanoic acid.
| Compound Name | 4-[2-[4-carboxy-2-(2-formamidopropyl)hexanoyl]oxyethoxycarbonyl]-2-ethyl-6-formamidoheptanoic acid |
|---|---|
| PubChem CID | 154606960 |
| Molecular Formula | C24H40N2O10 |
| Molecular Weight | 516.59 g/mol |
| Exact Mass | 516.27 |
| IUPAC Name | 4-[2-[4-carboxy-2-(2-formamidopropyl)hexanoyl]oxyethoxycarbonyl]-2-ethyl-6-formamidoheptanoic acid |
| SMILES | CCC(CC(CC(C)NC=O)C(=O)OCCOC(=O)C(CC(C)NC=O)CC(CC)C(=O)O)C(=O)O |
| InChI | InChI=1S/C24H40N2O10/c1-5-17(21(29)30)11-19(9-15(3)25-13-27)23(33)35-7-8-36-24(34)20(10-16(4)26-14-28)12-18(6-2)22(31)32/h13-20H,5-12H2,1-4H3,(H,25,27)(H,26,28)(H,29,30)(H,31,32) |
| InChIKey | RDJICXDHGUABAV-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 185.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.59 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|