C14H17N3 — CID 123697560
N,N-dimethyl-2-prop-1-en-2-yl-5-(1H-pyrazol-4-yl)aniline (PubChem CID 123697560) has the molecular formula C14H17N3 and a molecular weight of 227.31 g/mol. Its IUPAC name is N,N-dimethyl-2-prop-1-en-2-yl-5-(1H-pyrazol-4-yl)aniline.
| Compound Name | N,N-dimethyl-2-prop-1-en-2-yl-5-(1H-pyrazol-4-yl)aniline |
|---|---|
| PubChem CID | 123697560 |
| Molecular Formula | C14H17N3 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.14 |
| IUPAC Name | N,N-dimethyl-2-prop-1-en-2-yl-5-(1H-pyrazol-4-yl)aniline |
| SMILES | C=C(C)c1ccc(-c2cn[nH]c2)cc1N(C)C |
| InChI | InChI=1S/C14H17N3/c1-10(2)13-6-5-11(7-14(13)17(3)4)12-8-15-16-9-12/h5-9H,1H2,2-4H3,(H,15,16) |
| InChIKey | SMXBDONXAWDURR-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |